2',3'-O-Bis(tert-butyldimethylsilyl)-5'-O-(dimethoxytrityl)uridine
2',3'-O-Bis(tert-butyldimethylsilyl)-5'-O-(dimethoxytrityl)uridine, an indispensable entity in biomedical research and the pharmaceutical sector, assumes a pivotal role. It serves as a critical element in the construction of altered nucleosides, holding great promise in the creation of antiviral medications and potential remedies for diverse ailments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 82444-76-6 |
| Pricing | Inquire |
| Cas | 82444-76-6 |
| Molecular Weight | 775.09 |
| Molecular Formula | C42H58N2O8Si2 |
| Canonical SMILES | CC(C)(C)[Si](C)(C)OC1C(OC(C1O[Si](C)(C)C(C)(C)C)N2C=CC(=O)NC2=O)COC(C3=CC=CC=C3)(C4=CC=C(C=C4)OC)C5=CC=C(C=C5)OC |