Nemifitide acetate
Nemifitide acetate is an antidepressant with a pentapeptide structure similar to melanocyte-inhibiting factor (MIF). It binds to several receptors, including 5-HT2A (as an antagonist), NPY1, bombesin, MC4, and MC5, although only in micromolar concentrations.
| Supplier | BOC Sciences |
|---|---|
| Product # | BAT-016300 |
| Pricing | Inquire |
| Molecular Weight | 754.85 |
| Molecular Formula | C35H47FN10O8 |
| Canonical SMILES | CC(=O)O.C1C(CN(C1C(=O)NC(CCCN=C(N)N)C(=O)NCC(=O)NC(CC2=CNC3=CC=CC=C32)C(=O)N)C(=O)C(CC4=CC=C(C=C4)F)N)O |