2,6-Difluorobenzoyl chloride
2,6-Difluorobenzoyl chloride (CAS# 18063-02-0) is used in the synthesis of a series of novel 2-aryl substituted 4H-3,1-benzoxazin-4-ones which are used as specific inhibitors of the Tissue Factor (TF)/Factor VIIa (FVIIa)-induced pathway of coagulation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 18063-02-0 |
| Pricing | Inquire |
| Cas | 18063-02-0 |
| Molecular Weight | 176.55 |
| Molecular Formula | C7H3ClF2O |
| Canonical SMILES | C1=CC(=C(C(=C1)F)C(=O)Cl)F |