Biotin-[d4]
Biotin-[d4], is the labeled analogue of Biotin. Biotin is involved in a wide range of metabolic processes, both in humans and in other organisms, primarily related to the utilization of fats, carbohydrates, and amino acids.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001599 |
| Pricing | Inquire |
| Cas | 1217850-77-5 |
| Molecular Weight | 248.34 |
| Molecular Formula | C10H12D4N2O3S |
| Canonical SMILES | C1C2C(C(S1)CCCCC(=O)O)NC(=O)N2 |