Diphenyl-1-pyrenylphosphine
Diphenyl-1-pyrenylphosphine is a probe that reacts stoichiometrically with hydroperoxides to yield the fluorescent molecule diphenyl-1-pyrenylphosphine oxide (DPPP-O). DPPP has also been used as a fluorescent probe for the detection of low density lipoprotein and cellular oxidation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 110231-30-6 |
| Pricing | Inquire |
| Cas | 110231-30-6 |
| Molecular Weight | 386.4 |
| Molecular Formula | C28H19P |
| Canonical SMILES | C1=CC=C(C=C1)P(C2=CC=CC=C2)C3=C4C=CC5=CC=CC6=C5C4=C(C=C6)C=C3 |