Famotidine Impurity D-[13C,d4]
Famotidine Impurity D-[13C,d4] is the labelled analogue of Famotidine Impurity D, which is an impurity of Famotidine. Famotidine is a Histamine H2 receptor antagonist medication that decreases stomach acid production.
Supplier | BOC Sciences |
---|---|
Product # | BLP-005433 |
Pricing | Inquire |
Cas | 1327321-45-8 |
Molecular Weight | 264.37 |
Molecular Formula | C7[13C]H9D4N5S2 |
Canonical SMILES | C1=C(N=C(S1)N=C(N)N)CSCCC(=O)N |