Chloropolysporin B
Chloropolysporin B is produced by the strain of Faenia interjecta SANK 60983. It has strong activity of anti-gram-positive bacteria, including clinically isolated methicillin-resistant Staphylococcus aureus (MRSA) and enterococcus bacteria. Chloropolysporin B and other glycopeptide antibiotics can also promote the growth of broiler chickens.
Supplier | BOC Sciences |
---|---|
Product # | BBF-00317 |
Pricing | Inquire |
Cas | 105650-11-1 |
Molecular Weight | 1848.98 |
Molecular Formula | C83H89Cl3N8O34 |
Canonical SMILES | CC1C(C(CC(O1)OC2C3C(=O)NC(C4=C(C(=CC(=C4)O)O)C5=C(C=CC(=C5)C(C(=O)N3)NC(=O)C6C7=CC(=C(C(=C7)OC8=C(C=C(C=C8)C(C(C(=O)NC(C(=O)N6)C9=CC(=C(C=C9)O)Cl)NC(=O)C(C1=CC=C(C=C1)OC1C(C(C(C(O1)C)O)O)O)NC)OC1C(C(C(C(O1)CO)O)O)O)Cl)OC1C(C(C(C(O1)CO)O)O)O)OC1=C(C=C2C=C1)Cl)O)C(=O)O)N)O |