2-(2-(Benzyloxy)ethoxy)ethyl 4-methylbenzenesulfonate
2-(2-(Benzyloxy)ethoxy)ethyl 4-methylbenzenesulfonate is a PEG linker with an acid labile, benzyl protecting group. The tosyl group is a good leaving group. The hydrophilic PEG linker increases the water solubility of the compound in aqueous solutions.
Supplier | BOC Sciences |
---|---|
Product # | BP-500313 |
Pricing | Inquire |
Cas | 98627-22-6 |
Molecular Weight | 350.43 |
Molecular Formula | C18H22O5S |
Canonical SMILES | CC1=CC=C(C=C1)S(=O)(=O)OCCOCCOCC2=CC=CC=C2 |