Pregnenolone-20,21-13C2-16,16-[d2] sulfate sodium salt
Labelled form of Pregnenolone sulfate sodium salt. Pregnenolone sulfate, a metabolite of the natural steroid hormone pregnenolone, is a neurosteroid that has been demonstrated to antagonize the GABAA receptor chloride channel.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-001196 |
| Pricing | Inquire |
| Molecular Weight | 422.52 |
| Molecular Formula | C19[13C]2H29D2NaO5S |
| Canonical SMILES | CC(=O)C1CCC2C1(CCC3C2CC=C4C3(CCC(C4)OS(=O)(=O)[O-])C)C.[Na+] |