Chondramide B
It is produced by the strain of Chondromyces crocatus. Chondramide B has anti-candida, Henson yeast, lipids yeast, ball-like yeast and other fungal activities, but has no anti-gram positive and negative bacteria activities.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00323 |
| Pricing | Inquire |
| Molecular Weight | 681.22 |
| Molecular Formula | C36H45ClN4O7 |
| Canonical SMILES | CC1CC(=CC(C(OC(=O)C(C(NC(=O)C(N(C(=O)C(NC1=O)C)C)CC2=C(NC3=CC=CC=C32)Cl)C4=CC=C(C=C4)O)OC)C)C)C |