(4-(Hydroxymethyl)phenyl)(phenyl)methanone
(4-(Hydroxymethyl)phenyl)(phenyl)methanone can be useful in the synthesis of trifluoromethylaryl diazirine and benzophenone derivatives of etomidate that are potent general anesthetics and effective photolabels for probing sites on ligand-gated ion channels. It can be useful in the synthesis of protein crosslinkers and other probes for protein labeling.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB061146 |
| Pricing | Inquire |
| Cas | 81449-01-6 |
| Molecular Weight | 212.24 |
| Molecular Formula | C14H12O2 |
| Canonical SMILES | C1=CC=C(C=C1)C(=O)C2=CC=C(C=C2)CO |