5-Fluoro-1-(2',3'-dideoxy-2',3'-didehydro-5'-O-acetyl-b-L-ribofuranosyl)-uracil
5-Fluoro-1-(2',3'-dideoxy-2',3'-didehydro-5'-O-acetyl-b-L-ribofuranosyl)-uracil is a highly efficacious synthetic nucleoside analog utilized in the research of human immunodeficiency virus (HIV) infection. Its mechanism of action involves robust inhibition of HIV reverse transcriptase, impeding viral replication and significantly ameliorating viral burden.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1421336-32-4 |
| Pricing | Inquire |
| Cas | 1421336-32-4 |
| Molecular Weight | 270.22 |
| Molecular Formula | C11H11FN2O5 |
| Canonical SMILES | CC(=O)OCC1C=CC(O1)N2C=C(C(=O)NC2=O)F |