GLP-1 receptor agonist 4
GLP-1 receptor agonist 4, a glucagon-like peptide-1 receptor (GLP-1R) agonist with an EC50 of 64.5 nM, can be used in the study of diabetes treatment. (Extracted from patent WO2009111700A2, compound 87)
| Supplier | BOC Sciences |
|---|---|
| Product # | 1187061-62-6 |
| Pricing | Inquire |
| Cas | 1187061-62-6 |
| Molecular Weight | 879.82 |
| Molecular Formula | C51H44Cl2N4O6 |
| Canonical SMILES | CCC(C1=CC=CC=C1)N2CC3=CC4=C(C=C3CC2C(=O)NC(CC5=CC=C(C=C5)C6=CC=C(C=C6)C#N)C(=O)O)N(C(=O)C(O4)C7=CC=C(C=C7)OCC8=CC(=C(C=C8)Cl)Cl)C |