Melamine phosphate (1:1)
Melamine phosphate (1:1) is an invaluable compound extensively employed in the research a diverse array of diseases. Recognized for its remarkable antimicrobial attributes, it exhibits considerable promise in studying pernicious bacterial infections. Furthermore, its potential in studying inflammation and fostering expedited wound healing has been thoroughly investigated.
| Supplier | BOC Sciences |
|---|---|
| Product # | 20208-95-1 |
| Pricing | Inquire |
| Cas | 20208-95-1 |
| Molecular Weight | 224.12 |
| Molecular Formula | C3H6N6.H3O4P |
| Canonical SMILES | C1(=NC(=NC(=N1)N)N)N.OP(=O)(O)O |