Levomefolate-[d4]
Levomefolate-[d4] is an isotope labelled of Levomefolate, a natural, active form of folic acid used at the cellular level for DNA reproduction, the cysteine cycle and the regulation of homocysteine among other functions.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-004384 |
| Pricing | Inquire |
| Cas | 461426-39-1 |
| Molecular Weight | 463.48 |
| Molecular Formula | C20H21D4N7O6 |
| Canonical SMILES | CN1C(CNC2=C1C(=O)NC(=N2)N)CNC3=CC=C(C=C3)C(=O)NC(CCC(=O)O)C(=O)O |