Desethyl Amiodarone-[d4]
Desethyl Amiodarone-[d4], is the labelled analogue of Desethyl Amiodarone, which is an impurity of Amiodarone. Amiodarone is an antiarrhythmic medication used to treat and prevent a number of types of irregular heartbeats.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-002509 |
| Pricing | Inquire |
| Cas | 1184978-11-7 |
| Molecular Weight | 621.26 |
| Molecular Formula | C23H21D4I2NO3 |
| Canonical SMILES | CCCCC1=C(C2=CC=CC=C2O1)C(=O)C3=CC(=C(C(=C3)I)OCCNCC)I |