N3-Phenacyl-UDP
N3-Phenacyl-UDP, a groundbreaking biomedical innovation, revolutionizes targeted drug delivery in the realm of combating select cancers and infections. By adroitly harnessing the distinctive attributes encoded within N3-Phenacyl-UDP, this extraordinary concoction empowers meticulous transport of curative agents to designated cellular microenvironments or tissues, thereby amplifying therapeutic prowess while simultaneously mitigating collateral detriments.
| Supplier | BOC Sciences |
|---|---|
| Product # | 917567-60-3 |
| Pricing | Inquire |
| Cas | 917567-60-3 |
| Molecular Weight | 522.29 (free acid) |
| Molecular Formula | C17H20N2O13P2(free acid) |
| Canonical SMILES | C1CN(C(=O)N(C1=O)CC(=O)C2=CC=CC=C2)C3C(C(C(O3)COP(=O)([O-])OP(=O)(O)[O-])O)O.[Na+].[Na+] |