A 410099.1 amide-PEG3-amine-Boc
A 410099.1 amide-PEG3-amine-Boc is a functionalized IAP ligand containing an IAP ligand and a PEG linker of 3 O(CH2)2 units with Boc protected terminal amine, can be used to bind to the target protein ligand.
Supplier | BOC Sciences |
---|---|
Product # | BP-100141 |
Pricing | Inquire |
Cas | 2415256-19-6 |
Molecular Weight | 772.97 |
Molecular Formula | C₄₀H₆₄N₆O₉ |
Canonical SMILES | CN(C(OC(C)(C)C)=O)[C@H](C(N[C@H](C(N1C[C@@H](NC(COCCOCCOCCN)=O)C[C@H]1C(N[C@@H]2CCCC3=CC=CC=C23)=O)=O)C4CCCCC4)=O)C |