4-amino-2-chloro-3-nitropyridine
4-amino-2-chloro-3-nitropyridine (CAS# 2789-25-5) is used as a reagent in the synthesis of imidazopyridine-based fatty acid synthase inhibitors which show anti-HCV activity. Also used as a reagent in the synthesis of acyclic nucleotides that are related to clitocine, which exhibit antiviral activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2789-25-5 |
| Pricing | Inquire |
| Cas | 2789-25-5 |
| Molecular Weight | 173.56 |
| Molecular Formula | C5H4ClN3O2 |
| Canonical SMILES | C1=CN=C(C(=C1N)[N+](=O)[O-])Cl |