Methyl acetyl ricinoleate
Methyl acetyl ricinoleate is an illustrious biomedical agent that unveils its key role in combatting diverse ailments. It assumes the position of a distinguished constituent within therapeutic entities, namely anti-inflammatory marvels and analgesics, by virtue of its superlative analgesic efficacy.
| Supplier | BOC Sciences |
|---|---|
| Product # | 140-03-4 |
| Pricing | Inquire |
| Cas | 140-03-4 |
| Molecular Weight | 354.53 |
| Molecular Formula | C21H38O4 |
| Canonical SMILES | CCCCCCC(CC=CCCCCCCCC(=O)OC)OC(=O)C |