3-Methyluric acid-2,4,5,6-[13C4],1,3,9-[15N3]
3-Methyluric acid-2,4,5,6-[13C4], 1,3,9-[15N3] is intended for use as an internal standard for 3-Methyluric Acid. 3-Methyluric Acid is a methylated derivative of uric acid that inhibits peroxynitrite-mediated oxidation, which has potential therapeutic application in the treatment of multiple sclerosis. 3-Methyluric Acid is also a known metabolite of Caffeine.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-005733 |
| Pricing | Inquire |
| Cas | 1173019-10-7 |
| Molecular Weight | 189.09 |
| Molecular Formula | [13C]4C2H6[15N]3NO3 |
| Canonical SMILES | CN1C2=C(C(=O)NC1=O)NC(=O)N2 |