Cephapirin
It is produced by the strain of Semisynthetic first generation cephalosporin for injection. It has the commonness of the first generation cephalosporin. The antibacterial spectrum is similar to cefthiophene, which is characterized by better activity against Streptococcus pneumoniae.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-00761 |
| Pricing | Inquire |
| Cas | 21593-23-7 |
| Molecular Weight | 423.47 |
| Molecular Formula | C17H17N306S2 |
| Canonical SMILES | CC(=O)OCC1=C(N2C(C(C2=O)NC(=O)CSC3=CC=NC=C3)SC1)C(=O)O |