Methyl 2,3,4-tri-O-acetyl-6-O-tert-butyldimethylsilyl-a-D-glucopyranoside
Methyl 2,3,4-tri-O-acetyl-6-O-tert-butyldimethylsilyl-α-D-glucopyranoside, a paramount compound extensively employed in the field of biomedicine, exhibits a multitude of pharmaceutical applications. Serving as a versatile intermediate for drug synthesis, this product holds particular significance in the realm of metabolic disorders and infectious diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 63734-11-2 |
| Pricing | Inquire |
| Cas | 63734-11-2 |
| Molecular Weight | 434.56 |
| Molecular Formula | C19H34O9Si |
| Canonical SMILES | CC(=O)OC1C(OC(C(C1OC(=O)C)OC(=O)C)OC)CO[Si](C)(C)C(C)(C)C |