4-Hydroxybenzenesulfonic Acid Ammonium Salt
4-Hydroxybenzenesulfonic Acid Ammonium Salt is the ammonium salt derivative of 4-Hydroxybenzenesulfonic Acid (H807805); a compound that is used as a redox-mediator in the laccase-catalyzed degradation of indigo, a textile dye.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063595 |
| Pricing | Inquire |
| Cas | 856777-15-6 |
| Molecular Weight | 191.2 |
| Molecular Formula | C6H9NO4S |
| Canonical SMILES | C1=CC(=CC=C1O)S(=O)(=O)O.N |