2,6-Di-tert-butyl-4-methylpyridine
2,6-Di-tert-butyl-4-methylpyridine (CAS# 38222-83-2) is used as a catalyst in the rapid assembly of complex oligosaccharides. Also a catalyst for the stereoselective construction of C(20) in steroidal derivatives in the synthesis of epimeric structural analogs in pharmaceuticals.
| Supplier | BOC Sciences |
|---|---|
| Product # | 38222-83-2 |
| Pricing | Inquire |
| Cas | 38222-83-2 |
| Molecular Weight | 205.34 |
| Molecular Formula | C14H23N |
| Canonical SMILES | CC1=CC(=NC(=C1)C(C)(C)C)C(C)(C)C |