N-(2,6-Diamino-6-hydroxymethylpimelyl)-L-alanine
N-(2,6-Diamino-6-hydroxymethylpimelyl)-L-alanine is produced by the strain of Micromonspora chalcea PA3534. On the synthetic medium, it showed anti-Escherichia coli activity, and was combined with several cell wall synthesis inhibitors such as fosfomycin, cycloserine, penicillin, and cephalosporin, the combination of sporozoin has obvious synergistic antibacterial effect.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01374 |
| Pricing | Inquire |
| Cas | 77625-76-4 |
| Molecular Weight | 291.30 |
| Molecular Formula | C11H21N3O6 |
| Canonical SMILES | CC(C(=O)O)NC(=O)C(CCCC(CO)(C(=O)O)N)N |