N3-Ethylpseudouridine
N3-Ethylpseudouridine, an indispensable compound in the realm of biomedicine, garners attention due to its immense scientific significance. This remarkable entity exhibits remarkable potential in combatting specific maladies such as cancer, viral infections, and autoimmune disorders. By regulating gene expression, impeding aberrant cell proliferation, and augmenting immune responses, it emerges as a promising therapeutic intervention.
| Supplier | BOC Sciences |
|---|---|
| Product # | 2413585-37-0 |
| Pricing | Inquire |
| Cas | 2413585-37-0 |
| Molecular Weight | 272.25 |
| Molecular Formula | C11H16N2O6 |
| Canonical SMILES | CCN1C(=O)C(=CNC1=O)C2C(C(C(O2)CO)O)O |