Kazusamycin B
A minor component of the leptomycin complex produced by some streptomyces sp.; an hydroxylated analogue of leptomycin A, a nuclear export inhibitor; displays potent antitumour activity against L1210 and human colon adenocarcinoma, and in vivo activity against P388 lymphocytic leukemia in mice; also possesses strong antibacterial and antifungal activity.
| Supplier | BOC Sciences |
|---|---|
| Product # | BBF-01888 |
| Pricing | Inquire |
| Cas | 107140-30-7 |
| Molecular Weight | 542.70 |
| Molecular Formula | C32H46O7 |
| Canonical SMILES | CC1C=CC(=O)OC1C=CC(=CC(C)CC=CC(=CC(CO)C(=O)C(C)C(C(C)CC(=CC(=O)O)C)O)C)C |