Cyclic GMP sodium salt
Cyclic GMP or cGMP is a second messenger and it is biosynthesized from GTP by guanylate cyclases. Nitric oxide and natriuretic peptides arw activators of guanylate cyclases. cGMP activates protein kinase G (PKG) and modulates ion channel conductance, with signaling affecting diverse processes including smooth muscle relaxation and proliferation, phototransduction, and energy homeostasis.
| Supplier | BOC Sciences |
|---|---|
| Product # | 40732-48-7 |
| Pricing | Inquire |
| Cas | 40732-48-7 |
| Molecular Weight | 367.2 |
| Molecular Formula | C10H11N5O7P·Na |
| Canonical SMILES | C1C2C(C(C(O2)N3C=NC4=C3N=C(NC4=O)N)O)OP(=O)(O1)[O-].[Na+] |