5'-Adenylic acid monoanhydride with (dichlorophosphonomethyl)phosphonic acid
5'-Adenylic acid monoanhydride with (dichlorophosphonomethyl)phosphonic acid is a compound commonly utilized as a research instrument to scrutinize nucleotide metabolism and regulation. Additionally, it is reputed to have potential and promising therapeutic applications in treating viral diseases, including HIV and herpes simplex virus.
| Supplier | BOC Sciences |
|---|---|
| Product # | 81336-74-5 |
| Pricing | Inquire |
| Cas | 81336-74-5 |
| Molecular Weight | 574.10 |
| Molecular Formula | C11H16Cl2N5O12P3 |
| Canonical SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)OP(=O)(CP(=O)(OCl)OCl)O)O)O)N |