Buflomedil impurity (o-desmethyl)
Buflomedil impurity (o-desmethyl) is a biomedical product used in drug analysand pharmaceutical therapy. This impurity is derived from Buflomedil is a drug used to treat peripheral vascular diseases like Raynaud's phenomenon and intermittent claudication. Its inclusion aids in the identification and characterization of Buflomedil's metabolites, facilitating comprehensive drug development and therapeutic efficacy assessment.
| Supplier | BOC Sciences |
|---|---|
| Product # | 70585-57-8 |
| Pricing | Inquire |
| Cas | 70585-57-8 |
| Molecular Weight | 292.40 |
| Molecular Formula | C17H26NO3 |
| Canonical SMILES | COC1=CC(=C(C(=C1)OC)C(=O)CCCN2CCCC2)O.Cl |