SGC2085 HCl
SGC2085, also called as GTPL9259, is a potent and selective Coactivator Associated Arginine Methyltransferase 1 (CARM1) Inhibitor with an IC50 of 50 nM and more than undred-fold selectivity over other PRMTs.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1821908-49-9 |
| Pricing | Inquire |
| Cas | 1821908-49-9 |
| Molecular Weight | 348.87 |
| Molecular Formula | C19H25ClN2O2 |
| Canonical SMILES | CC1=CC(=CC(=C1)OC2=C(C=C(C=C2)CNC(=O)C(C)N)C)C.Cl |