Xanthurenic Acid-[d4]
Labelled Xanthurenic Acid. Xanthurenic acid acts as an endogenous Group II metabotropic glutamate receptor (mGluR2 and mGluR3) agonist in transfected HEK293 cells at nanomolar concentrations. It suppresses cAMP formation in mouse cortical slices expressing mGlu2 and mGlu3 receptors.
| Supplier | BOC Sciences |
|---|---|
| Product # | BLP-007629 |
| Pricing | Inquire |
| Cas | 1329611-28-0 |
| Molecular Weight | 209.19 |
| Molecular Formula | C10H3D4NO4 |
| Canonical SMILES | C1=CC2=C(C(=C1)O)N=C(C=C2O)C(=O)O |