trans-Dihydrophthalic Acid
trans-Dihydrophthalic Acid is used synthesis in-situ of the class of compds. known generally as MOFs (metal org. frameworks or organometallic compds.), COFs (covalent org. frameworks), and ZIFs (Zeolitic imidazolate framework), within and onto different types of substrates, and to the applications of such substrates having in-situ synthesized MOFs, COFs and ZIFs.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB068612 |
| Pricing | Inquire |
| Cas | 5675-13-8 |
| Molecular Weight | 168.15 |
| Molecular Formula | C8H8O4 |
| Canonical SMILES | C1=CC(C(C=C1)C(=O)O)C(=O)O |