Thymidine-5'-carboxylic acid
Thymidine-5'-carboxylic acid is a remarkable biomedical compound, exhibiting immense potential in studying a plethora of ailments linked to DNA synthesis and reparative processes. Its pivotal contribution to nucleic acid metabolism renders it indispensable in the realm of molecular biology investigations, where it predominantly serves as a precursor for an array of thymidine derivatives.
| Supplier | BOC Sciences |
|---|---|
| Product # | 3544-99-8 |
| Pricing | Inquire |
| Cas | 3544-99-8 |
| Molecular Weight | 256.21 |
| Molecular Formula | C10H12N2O6 |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)C(=O)O)O |