N6-Benzoyl-5'-O-(dimethoxytrityl)-3'-deoxyadenosine
N6-Benzoyl-5'-O-(dimethoxytrityl)-3'-deoxyadenosine is an essential constituent in the biomedical sector, acting as a fundamental precursor in the amalgamation of diverse pharmaceutics and investigative substances. This compound notably contributes to advancing the development of antiviral drugs .
| Supplier | BOC Sciences |
|---|---|
| Product # | 84138-86-3 |
| Pricing | Inquire |
| Cas | 84138-86-3 |
| Molecular Weight | 657.71 |
| Molecular Formula | C38H35N5O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)OCC4CC(C(O4)N5C=NC6=C(N=CN=C65)NC(=O)C7=CC=CC=C7)O |