Thymidylyl-(3',5')-2'-deoxyguanosine
Thymidylyl-(3',5')-2'-deoxyguanosine, a vital biochemical, is extensively employed in biomedical research as a fundamental substrate for enzymes implicated in DNA synthesis, repair, and recombination. Scientists also employ it to fashion innovative antiviral drugs while fighting hard against the scourge of breast, colon, and lung cancer. Its versatile utility makes it an indispensable component of the modern biomedical arsenal.
| Supplier | BOC Sciences |
|---|---|
| Product # | 4251-20-1 |
| Pricing | Inquire |
| Cas | 4251-20-1 |
| Molecular Weight | 571.40 |
| Molecular Formula | C20H26N7O11P |
| Canonical SMILES | CC1=CN(C(=O)NC1=O)C2CC(C(O2)OP(=O)(O)OCC3C(CC(O3)N4C=NC5=C4N=C(NC5=O)N)O)CO |