A2ti-1
A2ti-1 is a selective and high-affinity inhibitor of annexin A2/S100A10 heterotetramer (A2t) with an IC50 of 24 μM. A2ti-1 specifically disrupts the protein-protein interaction (PPI) between A2 and S100A10. It protects against human papillomavirus type 16 (HPV16) infection.
| Supplier | BOC Sciences |
|---|---|
| Product # | 570390-00-0 |
| Pricing | Inquire |
| Cas | 570390-00-0 |
| Molecular Weight | 382.48 |
| Molecular Formula | C20H22N4O2S |
| Canonical SMILES | CCC1=CC=CC=C1N2C(=NN=C2SCC(=O)N)COC3=CC=CC=C3C |