Nitromethanetrispropionic acid
Nitromethanetrispropionic acid is an indispensible compound in the biomedical sector and manifests remarkable promise as an efficacious cancer treatment. Its distinct chemical configuration contributes to its efficacy in selectively obstructing and restraining tumor proliferation.
| Supplier | BOC Sciences |
|---|---|
| Product # | 59085-15-3 |
| Pricing | Inquire |
| Cas | 59085-15-3 |
| Molecular Weight | 277.23 |
| Molecular Formula | C10H15NO8 |
| Canonical SMILES | C(CC(CCC(=O)O)(CCC(=O)O)[N+](=O)[O-])C(=O)O |