2-(Di-1-adamantylphosphino)dimethylaminobenzene, 97% Me-DalPhos
2-(Di-1-adamantylphosphino)dimethylaminobenzene, 97% Me-DalPhos, is a phosphine ligand in biomedical research. It primarily aids in metal-catalyzed reactions, leading to the formation of bioactive molecules. Notably applied in the synthesis of antineoplastic agents targeting cancer cells.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1219080-77-9 |
| Pricing | Inquire |
| Cas | 1219080-77-9 |
| Molecular Weight | 421.60 |
| Molecular Formula | C28H40NP |
| Canonical SMILES | CN(C)C1=CC=CC=C1P(C23CC4CC(C2)CC(C4)C3)C56CC7CC(C5)CC(C7)C6 |