2-Azido-1,6-di-O-acetyl-3,4-di-O-benzyl-D-glucopyranoside
2-Azido-1,6-di-O-acetyl-3,4-di-O-benzyl-D-glucopyranoside is a fascinating chemical entity that finds its applications in the field of biomedicine to synthesize glycopeptides and glycoconjugates. This compound bestows a unique opportunity to probe protein-carbohydrate interactions and unravel the underlying mechanisms governing glycobiology. Its profound significance in the realm of biomedicine is attributed to its exceptional perplexity and burstiness, thereby highlighting its paramount role in modern scientific research.
| Supplier | BOC Sciences |
|---|---|
| Product # | 136172-58-2 |
| Pricing | Inquire |
| Cas | 136172-58-2 |
| Molecular Weight | 469.5 |
| Molecular Formula | C24H27N3O7 |
| Canonical SMILES | CC(=O)OCC1C(C(C(C(O1)OC(=O)C)N=[N+]=[N-])OCC2=CC=CC=C2)OCC3=CC=CC=C3 |