Xanomeline oxalate
Muscarinic receptors are G protein-coupled acetylcholine receptors that play diverse roles. Xanomeline oxalate is a potent agonist of muscarinic acetylcholine receptors (EC50 values are 0.3, 92.5, 5, 52, and 42 nM for M1, M2, M3, M4, and M5, respectively). It has antipsychotic-like activities in rats and Cebus monkeys. M1 selective agonists, like Xanomeline oxalate, enhance memory function and has utility in treating Alzheimer's Disease.
| Supplier | BOC Sciences |
|---|---|
| Product # | 141064-23-5 |
| Pricing | Inquire |
| Cas | 141064-23-5 |
| Molecular Weight | 371.45 |
| Molecular Formula | C16H25N3O5S |
| Canonical SMILES | CCCCCCOC1=NSN=C1C2=CCCN(C2)C.C(=O)(C(=O)O)O |