5'-O-DMT-N4-Acetyl-2'-deoxycytidine 3'-CE phosphoramidite
5'-O-DMT-N4-Acetyl-2'-deoxycytidine 3'-CE phosphoramidite, a pivotal compound in the field of biomedical research, holds immense significance. Its multifarious applications transcend diverse medical domains and contribute to the advancement of disease therapeutics. Specifically, it plays a crucial role in drug development, propelling breakthroughs in cancer treatment and combating viral infections. The distinctive configuration and inherent characteristics of this compound render it indispensable in pharmaceutical synthesis.
| Supplier | BOC Sciences |
|---|---|
| Product # | B1370-337163 |
| Pricing | Inquire |
| Cas | 154110-40-4 |
| Molecular Weight | 771.86 |
| Molecular Formula | C41H50N5O8P |
| Canonical SMILES | CC(C)N(C(C)C)P(OCCC#N)OC1CC(OC1COC(C2=CC=CC=C2)(C3=CC=C(C=C3)OC)C4=CC=C(C=C4)OC)N5C=CC(=NC5=O)NC(=O)C |