4- (4, 4, 5, 5- Tetramethyl- 1, 3, 2- dioxaborolan- 2- yl) - L- phenylalanine Hydrochloride
4- (4, 4, 5, 5- Tetramethyl- 1, 3, 2- dioxaborolan- 2- yl) - L- phenylalanine Hydrochloride is a reactant used in the preparation of boronic acid- peptide hybrids for used as carbohydrate sensors and cell diagnostics.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB056890 |
| Pricing | Inquire |
| Cas | 1060765-21-0 |
| Molecular Weight | 291.15 + (36.46) |
| Molecular Formula | C15H22BNO4·HCl |
| Canonical SMILES | B1(OC(C(O1)(C)C)(C)C)C2=CC=C(C=C2)CC(C(=O)O)N.Cl |