2-Keto-4-methyl-[d3]-pentanoic acid sodium salt
2-Keto-4-methyl-[d3]-pentanoic acid sodium salt is an isotope analogue of 4-methyl-2-oxo-pentanoic acid, monosodium salt. 4-methyl-2-Oxovalerate is an immediate precursor and metabolite of L-leucine. It is a precursor leading to the synthesis of 2-methylpropyl glucosinolate, via L-leucine, in plants.
Supplier | BOC Sciences |
---|---|
Product # | 93523-67-2 |
Pricing | Inquire |
Molecular Weight | 155.14 |
Molecular Formula | C6H5D3NaO3 |
Canonical SMILES | CC(C)CC(=O)C(=O)[O-].[Na+] |