1-Naphthylzinc iodide solution
1-Naphthylzinc iodide solution is a reagent extensively used in biomedical research. It mainly serves in the creation of pharmaceutical compounds, specifically in the synthesis of anti-cancer and anti-viral drugs, streamlining the development of treatments for various diseases.
| Supplier | BOC Sciences |
|---|---|
| Product # | 46000-10-6 |
| Pricing | Inquire |
| Cas | 46000-10-6 |
| Molecular Weight | 319.46 |
| Molecular Formula | C10H7ZnI |
| Canonical SMILES | C1=CC=C2[C-]=CC=CC2=C1.[Zn+]I |