Venlafaxine EP Impurity C (R-Isomer)
Venlafaxine EP Impurity C (R-Isomer) is an impurity of Venlafaxine, which is an antidepressant medication of the serotonin-norepinephrine reuptake inhibitor (SNRI) class used to treat major depressive disorder, generalized anxiety disorder, panic disorder, and social anxiety disorder.
| Supplier | BOC Sciences |
|---|---|
| Product # | 1809202-18-3 |
| Pricing | Inquire |
| Cas | 1809202-18-3 |
| Molecular Weight | 249.35 |
| Molecular Formula | C15H23NO2 |
| Canonical SMILES | COC1=CC=C(C=C1)C(CN)C2(CCCCC2)O |