(D)-(+)-Neopterin
Neopterin, a pyrazino-pyrimidine compound derived from GTP, n is a precursor of tetrahydrobiopterin and can be used as a biochemical marker indicative of cell proliferation. Neopterin is synthesized in response to interferon-γ stimulation, and used as a marker of T helper cell-induced immune activation. Neopterin is also an indicator of oxidative stress, and modulates the effects of reactive oxygen species (ROS).
| Supplier | BOC Sciences |
|---|---|
| Product # | B2693-070923 |
| Pricing | Inquire |
| Cas | 2009-64-5 |
| Molecular Weight | 253.21 |
| Molecular Formula | C9H11N5O4 |
| Canonical SMILES | C1=C(N=C2C(=N1)NC(=NC2=O)N)C(C(CO)O)O |