6, 7- Dimethoxy- 3, 3- bis(4- methoxyphenyl) benzo[3, 4] fluoreno[2, 1- b] pyran- 13(3H) - one
6, 7- Dimethoxy- 3, 3- bis(4- methoxyphenyl) benzo[3, 4] fluoreno[2, 1- b] pyran- 13(3H) - one is used as a reagent in the preparation of multi-substituted indene condensed cyclonaphthopyran photochromic compound.
| Supplier | BOC Sciences |
|---|---|
| Product # | BB063209 |
| Pricing | Inquire |
| Cas | 329786-33-6 |
| Molecular Weight | 556.6 |
| Molecular Formula | C36H28O6 |
| Canonical SMILES | COC1=CC=C(C=C1)C2(C=CC3=C(O2)C4=CC(=C(C=C4C5=C3C(=O)C6=CC=CC=C65)OC)OC)C7=CC=C(C=C7)OC |