Leukotriene C4
Leukotriene C4 is a cysteinyl leukotriene produced by the LTC4 synthase catalyzed conjugation of glutathione to LTA4. LTC4 acts as an agonist of smooth muscle contraction. LTC4-induced bronchoconstriction and enhanced vascular permeability contribute to the pathogenesis of asthma and acute allergic hypersensitivity.
| Supplier | BOC Sciences |
|---|---|
| Product # | 72025-60-6 |
| Pricing | Inquire |
| Cas | 72025-60-6 |
| Molecular Weight | 625.78 |
| Molecular Formula | C30H47N3O9S |
| Canonical SMILES | CCCCCC=CCC=CC=CC=CC(C(CCCC(=O)O)O)SCC(C(=O)NCC(=O)O)NC(=O)CCC(C(=O)O)N |